C32H27Cl2FN2O5 — CID 66656587
(3R,4'S,6'R)-6-chloro-4'-(3-chlorocyclohexa-2,4-dien-1-yl)-6'-[5-fluoro-2-[4-(2-hydroxyethoxy)phenoxy]phenyl]spiro[1H-indole-3,5'-piperidine]-2,2'-dione (PubChem CID 66656587) has the molecular formula C32H27Cl2FN2O5 and a molecular weight of 609.48 g/mol. Its IUPAC name is (3R,4'S,6'R)-6-chloro-4'-(3-chlorocyclohexa-2,4-dien-1-yl)-6'-[5-fluoro-2-[4-(2-hydroxyethoxy)phenoxy]phenyl]spiro[1H-indole-3,5'-piperidine]-2,2'-dione.
| Compound Name | (3R,4'S,6'R)-6-chloro-4'-(3-chlorocyclohexa-2,4-dien-1-yl)-6'-[5-fluoro-2-[4-(2-hydroxyethoxy)phenoxy]phenyl]spiro[1H-indole-3,5'-piperidine]-2,2'-dione |
|---|---|
| PubChem CID | 66656587 |
| Molecular Formula | C32H27Cl2FN2O5 |
| Molecular Weight | 609.48 g/mol |
| Exact Mass | 608.13 |
| IUPAC Name | (3R,4'S,6'R)-6-chloro-4'-(3-chlorocyclohexa-2,4-dien-1-yl)-6'-[5-fluoro-2-[4-(2-hydroxyethoxy)phenoxy]phenyl]spiro[1H-indole-3,5'-piperidine]-2,2'-dione |
| SMILES | O=C1C[C@@H](C2C=C(Cl)C=CC2)[C@]2(C(=O)Nc3cc(Cl)ccc32)[C@@H](c2cc(F)ccc2Oc2ccc(OCCO)cc2)N1 |
| InChI | InChI=1S/C32H27Cl2FN2O5/c33-19-3-1-2-18(14-19)26-17-29(39)37-30(32(26)25-10-4-20(34)15-27(25)36-31(32)40)24-16-21(35)5-11-28(24)42-23-8-6-22(7-9-23)41-13-12-38/h1,3-11,14-16,18,26,30,38H,2,12-13,17H2,(H,36,40)(H,37,39)/t18?,26-,30+,32-/m0/s1 |
| InChIKey | YQFDPLYPZOYZRQ-DKPPTGFLSA-N |
| XLogP | 6.41 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.48 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |