C32H26ClF3N2O5 — CID 67573600
(3R,4'S,6'R)-6-chloro-4'-(3,6-difluorocyclohexa-2,4-dien-1-yl)-6'-[5-fluoro-2-[4-(2-hydroxyethoxy)phenoxy]phenyl]spiro[1H-indole-3,5'-piperidine]-2,2'-dione (PubChem CID 67573600) has the molecular formula C32H26ClF3N2O5 and a molecular weight of 611.02 g/mol. Its IUPAC name is (3R,4'S,6'R)-6-chloro-4'-(3,6-difluorocyclohexa-2,4-dien-1-yl)-6'-[5-fluoro-2-[4-(2-hydroxyethoxy)phenoxy]phenyl]spiro[1H-indole-3,5'-piperidine]-2,2'-dione.
| Compound Name | (3R,4'S,6'R)-6-chloro-4'-(3,6-difluorocyclohexa-2,4-dien-1-yl)-6'-[5-fluoro-2-[4-(2-hydroxyethoxy)phenoxy]phenyl]spiro[1H-indole-3,5'-piperidine]-2,2'-dione |
|---|---|
| PubChem CID | 67573600 |
| Molecular Formula | C32H26ClF3N2O5 |
| Molecular Weight | 611.02 g/mol |
| Exact Mass | 610.15 |
| IUPAC Name | (3R,4'S,6'R)-6-chloro-4'-(3,6-difluorocyclohexa-2,4-dien-1-yl)-6'-[5-fluoro-2-[4-(2-hydroxyethoxy)phenoxy]phenyl]spiro[1H-indole-3,5'-piperidine]-2,2'-dione |
| SMILES | O=C1C[C@@H](C2C=C(F)C=CC2F)[C@]2(C(=O)Nc3cc(Cl)ccc32)[C@@H](c2cc(F)ccc2Oc2ccc(OCCO)cc2)N1 |
| InChI | InChI=1S/C32H26ClF3N2O5/c33-17-1-8-24-27(13-17)37-31(41)32(24)25(22-14-18(34)2-9-26(22)36)16-29(40)38-30(32)23-15-19(35)3-10-28(23)43-21-6-4-20(5-7-21)42-12-11-39/h1-10,13-15,22,25-26,30,39H,11-12,16H2,(H,37,41)(H,38,40)/t22?,25-,26?,30+,32-/m0/s1 |
| InChIKey | HFAJWKNJZJEHKZ-ZZBZOHDJSA-N |
| XLogP | 6.09 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.02 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |