C28H22ClIN2O5 — CID 88914368
(3S,4'R,6'R)-6-chloro-6'-[5-ethynyl-2-[4-(2-hydroxyethoxy)phenoxy]phenyl]-4'-iodospiro[1H-indole-3,5'-piperidine]-2,2'-dione (PubChem CID 88914368) has the molecular formula C28H22ClIN2O5 and a molecular weight of 628.85 g/mol. Its IUPAC name is (3S,4'R,6'R)-6-chloro-6'-[5-ethynyl-2-[4-(2-hydroxyethoxy)phenoxy]phenyl]-4'-iodospiro[1H-indole-3,5'-piperidine]-2,2'-dione.
| Compound Name | (3S,4'R,6'R)-6-chloro-6'-[5-ethynyl-2-[4-(2-hydroxyethoxy)phenoxy]phenyl]-4'-iodospiro[1H-indole-3,5'-piperidine]-2,2'-dione |
|---|---|
| PubChem CID | 88914368 |
| Molecular Formula | C28H22ClIN2O5 |
| Molecular Weight | 628.85 g/mol |
| Exact Mass | 628.03 |
| IUPAC Name | (3S,4'R,6'R)-6-chloro-6'-[5-ethynyl-2-[4-(2-hydroxyethoxy)phenoxy]phenyl]-4'-iodospiro[1H-indole-3,5'-piperidine]-2,2'-dione |
| SMILES | C#Cc1ccc(Oc2ccc(OCCO)cc2)c([C@H]2NC(=O)C[C@@H](I)[C@]23C(=O)Nc2cc(Cl)ccc23)c1 |
| InChI | InChI=1S/C28H22ClIN2O5/c1-2-16-3-10-23(37-19-7-5-18(6-8-19)36-12-11-33)20(13-16)26-28(24(30)15-25(34)32-26)21-9-4-17(29)14-22(21)31-27(28)35/h1,3-10,13-14,24,26,33H,11-12,15H2,(H,31,35)(H,32,34)/t24-,26-,28+/m1/s1 |
| InChIKey | VYXJPTIPFKGSGF-INOCPDNRSA-N |
| XLogP | 4.74 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.85 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|