C32H26Cl2N2O4S — CID 87086878
(3R,4'S,6'R)-6-chloro-4'-(3-chlorophenyl)-6'-[2-(2-hydroxyethoxy)-5-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)phenyl]spiro[1H-indole-3,5'-piperidine]-2,2'-dione (PubChem CID 87086878) has the molecular formula C32H26Cl2N2O4S and a molecular weight of 605.54 g/mol. Its IUPAC name is (3R,4'S,6'R)-6-chloro-4'-(3-chlorophenyl)-6'-[2-(2-hydroxyethoxy)-5-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)phenyl]spiro[1H-indole-3,5'-piperidine]-2,2'-dione.
| Compound Name | (3R,4'S,6'R)-6-chloro-4'-(3-chlorophenyl)-6'-[2-(2-hydroxyethoxy)-5-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)phenyl]spiro[1H-indole-3,5'-piperidine]-2,2'-dione |
|---|---|
| PubChem CID | 87086878 |
| Molecular Formula | C32H26Cl2N2O4S |
| Molecular Weight | 605.54 g/mol |
| Exact Mass | 604.10 |
| IUPAC Name | (3R,4'S,6'R)-6-chloro-4'-(3-chlorophenyl)-6'-[2-(2-hydroxyethoxy)-5-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)phenyl]spiro[1H-indole-3,5'-piperidine]-2,2'-dione |
| SMILES | O=C1C[C@@H](c2cccc(Cl)c2)[C@]2(C(=O)Nc3cc(Cl)ccc32)[C@@H](c2cc(C3=CC=CCC3=S)ccc2OCCO)N1 |
| InChI | InChI=1S/C32H26Cl2N2O4S/c33-20-5-3-4-19(14-20)25-17-29(38)36-30(32(25)24-10-9-21(34)16-26(24)35-31(32)39)23-15-18(8-11-27(23)40-13-12-37)22-6-1-2-7-28(22)41/h1-6,8-11,14-16,25,30,37H,7,12-13,17H2,(H,35,39)(H,36,38)/t25-,30+,32-/m0/s1 |
| InChIKey | HGNDDHIXUTXKPC-RMRIFHTGSA-N |
| XLogP | 6.31 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.54 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|