C27H21Cl2IN4O3 — CID 69276479
(3R,6'R,8'S)-6-chloro-8'-(3-chlorophenyl)-6'-(2-hydroxy-5-iodophenyl)-2'-methylspiro[1H-indole-3,7'-4,6,8,9-tetrahydropyrido[2,1-c][1,2,4]triazine]-2,3'-dione (PubChem CID 69276479) has the molecular formula C27H21Cl2IN4O3 and a molecular weight of 647.30 g/mol. Its IUPAC name is (3R,6'R,8'S)-6-chloro-8'-(3-chlorophenyl)-6'-(2-hydroxy-5-iodophenyl)-2'-methylspiro[1H-indole-3,7'-4,6,8,9-tetrahydropyrido[2,1-c][1,2,4]triazine]-2,3'-dione.
| Compound Name | (3R,6'R,8'S)-6-chloro-8'-(3-chlorophenyl)-6'-(2-hydroxy-5-iodophenyl)-2'-methylspiro[1H-indole-3,7'-4,6,8,9-tetrahydropyrido[2,1-c][1,2,4]triazine]-2,3'-dione |
|---|---|
| PubChem CID | 69276479 |
| Molecular Formula | C27H21Cl2IN4O3 |
| Molecular Weight | 647.30 g/mol |
| Exact Mass | 646.00 |
| IUPAC Name | (3R,6'R,8'S)-6-chloro-8'-(3-chlorophenyl)-6'-(2-hydroxy-5-iodophenyl)-2'-methylspiro[1H-indole-3,7'-4,6,8,9-tetrahydropyrido[2,1-c][1,2,4]triazine]-2,3'-dione |
| SMILES | CN1N=C2C[C@@H](c3cccc(Cl)c3)[C@]3(C(=O)Nc4cc(Cl)ccc43)[C@@H](c3cc(I)ccc3O)N2CC1=O |
| InChI | InChI=1S/C27H21Cl2IN4O3/c1-33-24(36)13-34-23(32-33)12-20(14-3-2-4-15(28)9-14)27(25(34)18-11-17(30)6-8-22(18)35)19-7-5-16(29)10-21(19)31-26(27)37/h2-11,20,25,35H,12-13H2,1H3,(H,31,37)/t20-,25+,27-/m0/s1 |
| InChIKey | VNUPBVGCJUNFMO-FESMNKHTSA-N |
| XLogP | 5.51 |
| TPSA | 85.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.30 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|