C27H21Cl2FN4O2 — CID 25120793
(6'R,8'S)-6-chloro-8'-(3-chlorophenyl)-6'-(5-fluoro-2-methylphenyl)spiro[1H-indole-3,7'-4,6,8,9-tetrahydro-2H-pyrido[2,1-c][1,2,4]triazine]-2,3'-dione (PubChem CID 25120793) has the molecular formula C27H21Cl2FN4O2 and a molecular weight of 523.40 g/mol. Its IUPAC name is (6'R,8'S)-6-chloro-8'-(3-chlorophenyl)-6'-(5-fluoro-2-methylphenyl)spiro[1H-indole-3,7'-4,6,8,9-tetrahydro-2H-pyrido[2,1-c][1,2,4]triazine]-2,3'-dione.
| Compound Name | (6'R,8'S)-6-chloro-8'-(3-chlorophenyl)-6'-(5-fluoro-2-methylphenyl)spiro[1H-indole-3,7'-4,6,8,9-tetrahydro-2H-pyrido[2,1-c][1,2,4]triazine]-2,3'-dione |
|---|---|
| PubChem CID | 25120793 |
| Molecular Formula | C27H21Cl2FN4O2 |
| Molecular Weight | 523.40 g/mol |
| Exact Mass | 522.10 |
| IUPAC Name | (6'R,8'S)-6-chloro-8'-(3-chlorophenyl)-6'-(5-fluoro-2-methylphenyl)spiro[1H-indole-3,7'-4,6,8,9-tetrahydro-2H-pyrido[2,1-c][1,2,4]triazine]-2,3'-dione |
| SMILES | Cc1ccc(F)cc1[C@H]1N2CC(=O)NN=C2C[C@@H](c2cccc(Cl)c2)C12C(=O)Nc1cc(Cl)ccc12 |
| InChI | InChI=1S/C27H21Cl2FN4O2/c1-14-5-7-18(30)11-19(14)25-27(20-8-6-17(29)10-22(20)31-26(27)36)21(15-3-2-4-16(28)9-15)12-23-32-33-24(35)13-34(23)25/h2-11,21,25H,12-13H2,1H3,(H,31,36)(H,33,35)/t21-,25+,27?/m0/s1 |
| InChIKey | MFJKOZLIXROBFO-WLUWSMMMSA-N |
| XLogP | 5.30 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.40 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |