C33H33Cl2FN4O3 — CID 24788389
2-[(2'R,3R,4'S)-6-chloro-4'-(3-chlorophenyl)-2'-(5-fluoro-2-methylphenyl)-2,6'-dioxospiro[1H-indole-3,3'-piperidine]-1'-yl]-N-(1-methylpiperidin-4-yl)acetamide (PubChem CID 24788389) has the molecular formula C33H33Cl2FN4O3 and a molecular weight of 623.56 g/mol. Its IUPAC name is 2-[(2'R,3R,4'S)-6-chloro-4'-(3-chlorophenyl)-2'-(5-fluoro-2-methylphenyl)-2,6'-dioxospiro[1H-indole-3,3'-piperidine]-1'-yl]-N-(1-methylpiperidin-4-yl)acetamide.
| Compound Name | 2-[(2'R,3R,4'S)-6-chloro-4'-(3-chlorophenyl)-2'-(5-fluoro-2-methylphenyl)-2,6'-dioxospiro[1H-indole-3,3'-piperidine]-1'-yl]-N-(1-methylpiperidin-4-yl)acetamide |
|---|---|
| PubChem CID | 24788389 |
| Molecular Formula | C33H33Cl2FN4O3 |
| Molecular Weight | 623.56 g/mol |
| Exact Mass | 622.19 |
| IUPAC Name | 2-[(2'R,3R,4'S)-6-chloro-4'-(3-chlorophenyl)-2'-(5-fluoro-2-methylphenyl)-2,6'-dioxospiro[1H-indole-3,3'-piperidine]-1'-yl]-N-(1-methylpiperidin-4-yl)acetamide |
| SMILES | Cc1ccc(F)cc1[C@H]1N(CC(=O)NC2CCN(C)CC2)C(=O)C[C@@H](c2cccc(Cl)c2)[C@]12C(=O)Nc1cc(Cl)ccc12 |
| InChI | InChI=1S/C33H33Cl2FN4O3/c1-19-6-8-23(36)16-25(19)31-33(26-9-7-22(35)15-28(26)38-32(33)43)27(20-4-3-5-21(34)14-20)17-30(42)40(31)18-29(41)37-24-10-12-39(2)13-11-24/h3-9,14-16,24,27,31H,10-13,17-18H2,1-2H3,(H,37,41)(H,38,43)/t27-,31+,33-/m0/s1 |
| InChIKey | SWWSAFUJXPOFOB-QOCRQHEPSA-N |
| XLogP | 5.60 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.56 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |