C29H28Cl2FN3O3 — CID 143538319
2-[(2'S,3S,4'S)-6-chloro-2'-(3-chlorophenyl)-4'-methyl-2,6'-dioxospiro[1H-indole-3,3'-piperidine]-1'-yl]-N-methylacetamide;1-fluoro-4-methylbenzene (PubChem CID 143538319) has the molecular formula C29H28Cl2FN3O3 and a molecular weight of 556.47 g/mol. Its IUPAC name is 2-[(2'S,3S,4'S)-6-chloro-2'-(3-chlorophenyl)-4'-methyl-2,6'-dioxospiro[1H-indole-3,3'-piperidine]-1'-yl]-N-methylacetamide;1-fluoro-4-methylbenzene.
| Compound Name | 2-[(2'S,3S,4'S)-6-chloro-2'-(3-chlorophenyl)-4'-methyl-2,6'-dioxospiro[1H-indole-3,3'-piperidine]-1'-yl]-N-methylacetamide;1-fluoro-4-methylbenzene |
|---|---|
| PubChem CID | 143538319 |
| Molecular Formula | C29H28Cl2FN3O3 |
| Molecular Weight | 556.47 g/mol |
| Exact Mass | 555.15 |
| IUPAC Name | 2-[(2'S,3S,4'S)-6-chloro-2'-(3-chlorophenyl)-4'-methyl-2,6'-dioxospiro[1H-indole-3,3'-piperidine]-1'-yl]-N-methylacetamide;1-fluoro-4-methylbenzene |
| SMILES | CNC(=O)CN1C(=O)C[C@H](C)[C@@]2(C(=O)Nc3cc(Cl)ccc32)[C@@H]1c1cccc(Cl)c1.Cc1ccc(F)cc1 |
| InChI | InChI=1S/C22H21Cl2N3O3.C7H7F/c1-12-8-19(29)27(11-18(28)25-2)20(13-4-3-5-14(23)9-13)22(12)16-7-6-15(24)10-17(16)26-21(22)30;1-6-2-4-7(8)5-3-6/h3-7,9-10,12,20H,8,11H2,1-2H3,(H,25,28)(H,26,30);2-5H,1H3/t12-,20-,22-;/m0./s1 |
| InChIKey | WZYLLROLBASCHA-AUIGEEMLSA-N |
| XLogP | 5.67 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.47 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |