C28H29Cl2N5O3 — CID 59557329
N-[2-[(3R,6'R,8'S)-6'-but-1-en-2-yl-6-chloro-8'-(3-chlorophenyl)-2,3'-dioxospiro[1H-indole-3,7'-4,6,8,9-tetrahydropyrido[2,1-c][1,2,4]triazine]-2'-yl]ethyl]acetamide (PubChem CID 59557329) has the molecular formula C28H29Cl2N5O3 and a molecular weight of 554.48 g/mol. Its IUPAC name is N-[2-[(3R,6'R,8'S)-6'-but-1-en-2-yl-6-chloro-8'-(3-chlorophenyl)-2,3'-dioxospiro[1H-indole-3,7'-4,6,8,9-tetrahydropyrido[2,1-c][1,2,4]triazine]-2'-yl]ethyl]acetamide.
| Compound Name | N-[2-[(3R,6'R,8'S)-6'-but-1-en-2-yl-6-chloro-8'-(3-chlorophenyl)-2,3'-dioxospiro[1H-indole-3,7'-4,6,8,9-tetrahydropyrido[2,1-c][1,2,4]triazine]-2'-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 59557329 |
| Molecular Formula | C28H29Cl2N5O3 |
| Molecular Weight | 554.48 g/mol |
| Exact Mass | 553.16 |
| IUPAC Name | N-[2-[(3R,6'R,8'S)-6'-but-1-en-2-yl-6-chloro-8'-(3-chlorophenyl)-2,3'-dioxospiro[1H-indole-3,7'-4,6,8,9-tetrahydropyrido[2,1-c][1,2,4]triazine]-2'-yl]ethyl]acetamide |
| SMILES | C=C(CC)[C@H]1N2CC(=O)N(CCNC(C)=O)N=C2C[C@@H](c2cccc(Cl)c2)[C@]12C(=O)Nc1cc(Cl)ccc12 |
| InChI | InChI=1S/C28H29Cl2N5O3/c1-4-16(2)26-28(21-9-8-20(30)13-23(21)32-27(28)38)22(18-6-5-7-19(29)12-18)14-24-33-35(11-10-31-17(3)36)25(37)15-34(24)26/h5-9,12-13,22,26H,2,4,10-11,14-15H2,1,3H3,(H,31,36)(H,32,38)/t22-,26+,28-/m0/s1 |
| InChIKey | NLVIYNDGCFIRBN-MDBQKXLBSA-N |
| XLogP | 4.30 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.48 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|