C24H22Cl2N4O — CID 66878971
(3R,5'R,7'S)-6-chloro-7'-(3-chlorophenyl)-5'-pent-1-en-2-ylspiro[1H-indole-3,6'-7,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyridine]-2-one (PubChem CID 66878971) has the molecular formula C24H22Cl2N4O and a molecular weight of 453.37 g/mol. Its IUPAC name is (3R,5'R,7'S)-6-chloro-7'-(3-chlorophenyl)-5'-pent-1-en-2-ylspiro[1H-indole-3,6'-7,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyridine]-2-one.
| Compound Name | (3R,5'R,7'S)-6-chloro-7'-(3-chlorophenyl)-5'-pent-1-en-2-ylspiro[1H-indole-3,6'-7,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyridine]-2-one |
|---|---|
| PubChem CID | 66878971 |
| Molecular Formula | C24H22Cl2N4O |
| Molecular Weight | 453.37 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | (3R,5'R,7'S)-6-chloro-7'-(3-chlorophenyl)-5'-pent-1-en-2-ylspiro[1H-indole-3,6'-7,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyridine]-2-one |
| SMILES | C=C(CCC)[C@H]1n2cnnc2C[C@@H](c2cccc(Cl)c2)[C@]12C(=O)Nc1cc(Cl)ccc12 |
| InChI | InChI=1S/C24H22Cl2N4O/c1-3-5-14(2)22-24(18-9-8-17(26)11-20(18)28-23(24)31)19(12-21-29-27-13-30(21)22)15-6-4-7-16(25)10-15/h4,6-11,13,19,22H,2-3,5,12H2,1H3,(H,28,31)/t19-,22+,24-/m0/s1 |
| InChIKey | DGJCNPPHZUDHHZ-KWOQKUFVSA-N |
| XLogP | 5.71 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.37 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|