C30H32Cl2N4O4 — CID 25121486
tert-butyl 2-[(6'R,8'S)-6'-but-1-en-2-yl-6-chloro-8'-(3-chlorophenyl)-2,3'-dioxospiro[1H-indole-3,7'-4,6,8,9-tetrahydropyrido[2,1-c][1,2,4]triazine]-2'-yl]acetate (PubChem CID 25121486) has the molecular formula C30H32Cl2N4O4 and a molecular weight of 583.52 g/mol. Its IUPAC name is tert-butyl 2-[(6'R,8'S)-6'-but-1-en-2-yl-6-chloro-8'-(3-chlorophenyl)-2,3'-dioxospiro[1H-indole-3,7'-4,6,8,9-tetrahydropyrido[2,1-c][1,2,4]triazine]-2'-yl]acetate.
| Compound Name | tert-butyl 2-[(6'R,8'S)-6'-but-1-en-2-yl-6-chloro-8'-(3-chlorophenyl)-2,3'-dioxospiro[1H-indole-3,7'-4,6,8,9-tetrahydropyrido[2,1-c][1,2,4]triazine]-2'-yl]acetate |
|---|---|
| PubChem CID | 25121486 |
| Molecular Formula | C30H32Cl2N4O4 |
| Molecular Weight | 583.52 g/mol |
| Exact Mass | 582.18 |
| IUPAC Name | tert-butyl 2-[(6'R,8'S)-6'-but-1-en-2-yl-6-chloro-8'-(3-chlorophenyl)-2,3'-dioxospiro[1H-indole-3,7'-4,6,8,9-tetrahydropyrido[2,1-c][1,2,4]triazine]-2'-yl]acetate |
| SMILES | C=C(CC)[C@H]1N2CC(=O)N(CC(=O)OC(C)(C)C)N=C2C[C@@H](c2cccc(Cl)c2)C12C(=O)Nc1cc(Cl)ccc12 |
| InChI | InChI=1S/C30H32Cl2N4O4/c1-6-17(2)27-30(21-11-10-20(32)13-23(21)33-28(30)39)22(18-8-7-9-19(31)12-18)14-24-34-36(25(37)15-35(24)27)16-26(38)40-29(3,4)5/h7-13,22,27H,2,6,14-16H2,1,3-5H3,(H,33,39)/t22-,27+,30?/m0/s1 |
| InChIKey | MGTSQKVJRQWKEV-JDLOOTIESA-N |
| XLogP | 5.51 |
| TPSA | 91.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.52 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|