C30H35Cl2N3O3 — CID 68964798
(3S,4'R,6'S)-6-chloro-4'-(3-chlorophenyl)-1'-(3-morpholin-4-ylpropyl)-6'-[(Z)-pent-2-en-3-yl]spiro[1H-indole-3,5'-piperidine]-2,2'-dione (PubChem CID 68964798) has the molecular formula C30H35Cl2N3O3 and a molecular weight of 556.53 g/mol. Its IUPAC name is (3S,4'R,6'S)-6-chloro-4'-(3-chlorophenyl)-1'-(3-morpholin-4-ylpropyl)-6'-[(Z)-pent-2-en-3-yl]spiro[1H-indole-3,5'-piperidine]-2,2'-dione.
| Compound Name | (3S,4'R,6'S)-6-chloro-4'-(3-chlorophenyl)-1'-(3-morpholin-4-ylpropyl)-6'-[(Z)-pent-2-en-3-yl]spiro[1H-indole-3,5'-piperidine]-2,2'-dione |
|---|---|
| PubChem CID | 68964798 |
| Molecular Formula | C30H35Cl2N3O3 |
| Molecular Weight | 556.53 g/mol |
| Exact Mass | 555.21 |
| IUPAC Name | (3S,4'R,6'S)-6-chloro-4'-(3-chlorophenyl)-1'-(3-morpholin-4-ylpropyl)-6'-[(Z)-pent-2-en-3-yl]spiro[1H-indole-3,5'-piperidine]-2,2'-dione |
| SMILES | C/C=C(/CC)[C@@H]1N(CCCN2CCOCC2)C(=O)C[C@H](c2cccc(Cl)c2)[C@@]12C(=O)Nc1cc(Cl)ccc12 |
| InChI | InChI=1S/C30H35Cl2N3O3/c1-3-20(4-2)28-30(24-10-9-23(32)18-26(24)33-29(30)37)25(21-7-5-8-22(31)17-21)19-27(36)35(28)12-6-11-34-13-15-38-16-14-34/h3,5,7-10,17-18,25,28H,4,6,11-16,19H2,1-2H3,(H,33,37)/b20-3-/t25-,28+,30-/m1/s1 |
| InChIKey | RTJYDIMSKIHAAD-MEBBAQIGSA-N |
| XLogP | 5.65 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.53 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|