C31H39BrClN3O3 — CID 149330496
(2'R,3S,4'R,5'R)-4'-(3-bromophenyl)-6-chloro-2'-(2,2-dimethylpropyl)-5'-(5-morpholin-4-ylpentanoyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one (PubChem CID 149330496) has the molecular formula C31H39BrClN3O3 and a molecular weight of 617.03 g/mol. Its IUPAC name is (2'R,3S,4'R,5'R)-4'-(3-bromophenyl)-6-chloro-2'-(2,2-dimethylpropyl)-5'-(5-morpholin-4-ylpentanoyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one.
| Compound Name | (2'R,3S,4'R,5'R)-4'-(3-bromophenyl)-6-chloro-2'-(2,2-dimethylpropyl)-5'-(5-morpholin-4-ylpentanoyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one |
|---|---|
| PubChem CID | 149330496 |
| Molecular Formula | C31H39BrClN3O3 |
| Molecular Weight | 617.03 g/mol |
| Exact Mass | 615.19 |
| IUPAC Name | (2'R,3S,4'R,5'R)-4'-(3-bromophenyl)-6-chloro-2'-(2,2-dimethylpropyl)-5'-(5-morpholin-4-ylpentanoyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one |
| SMILES | CC(C)(C)C[C@H]1N[C@@H](C(=O)CCCCN2CCOCC2)[C@H](c2cccc(Br)c2)[C@@]12C(=O)Nc1cc(Cl)ccc12 |
| InChI | InChI=1S/C31H39BrClN3O3/c1-30(2,3)19-26-31(23-11-10-22(33)18-24(23)34-29(31)38)27(20-7-6-8-21(32)17-20)28(35-26)25(37)9-4-5-12-36-13-15-39-16-14-36/h6-8,10-11,17-18,26-28,35H,4-5,9,12-16,19H2,1-3H3,(H,34,38)/t26-,27+,28+,31+/m1/s1 |
| InChIKey | YCFGVBWVXJORHQ-LCUIVBHPSA-N |
| XLogP | 5.92 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.03 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|