C31H39Cl2FN4O2 — CID 58254389
(2'R,3S,4'S,5'R)-6-chloro-4'-(3-chloro-2-fluorophenyl)-2'-(2,2-dimethylpropyl)-5'-[4-(4-methylpiperazin-1-yl)butanoyl]spiro[1H-indole-3,3'-pyrrolidine]-2-one (PubChem CID 58254389) has the molecular formula C31H39Cl2FN4O2 and a molecular weight of 589.58 g/mol. Its IUPAC name is (2'R,3S,4'S,5'R)-6-chloro-4'-(3-chloro-2-fluorophenyl)-2'-(2,2-dimethylpropyl)-5'-[4-(4-methylpiperazin-1-yl)butanoyl]spiro[1H-indole-3,3'-pyrrolidine]-2-one.
| Compound Name | (2'R,3S,4'S,5'R)-6-chloro-4'-(3-chloro-2-fluorophenyl)-2'-(2,2-dimethylpropyl)-5'-[4-(4-methylpiperazin-1-yl)butanoyl]spiro[1H-indole-3,3'-pyrrolidine]-2-one |
|---|---|
| PubChem CID | 58254389 |
| Molecular Formula | C31H39Cl2FN4O2 |
| Molecular Weight | 589.58 g/mol |
| Exact Mass | 588.24 |
| IUPAC Name | (2'R,3S,4'S,5'R)-6-chloro-4'-(3-chloro-2-fluorophenyl)-2'-(2,2-dimethylpropyl)-5'-[4-(4-methylpiperazin-1-yl)butanoyl]spiro[1H-indole-3,3'-pyrrolidine]-2-one |
| SMILES | CN1CCN(CCCC(=O)[C@@H]2N[C@H](CC(C)(C)C)[C@]3(C(=O)Nc4cc(Cl)ccc43)[C@H]2c2cccc(Cl)c2F)CC1 |
| InChI | InChI=1S/C31H39Cl2FN4O2/c1-30(2,3)18-25-31(21-11-10-19(32)17-23(21)35-29(31)40)26(20-7-5-8-22(33)27(20)34)28(36-25)24(39)9-6-12-38-15-13-37(4)14-16-38/h5,7-8,10-11,17,25-26,28,36H,6,9,12-16,18H2,1-4H3,(H,35,40)/t25-,26+,28+,31+/m1/s1 |
| InChIKey | PHDONHGUWAEWTP-FJWGSAHKSA-N |
| XLogP | 5.48 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.58 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |