C29H34Cl2FN3O2 — CID 58254130
(2'R,3S,4'S,5'R)-5'-[2-[(1S,3R)-3-aminocyclopentyl]acetyl]-6-chloro-4'-(3-chloro-2-fluorophenyl)-2'-(2,2-dimethylpropyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one (PubChem CID 58254130) has the molecular formula C29H34Cl2FN3O2 and a molecular weight of 546.51 g/mol. Its IUPAC name is (2'R,3S,4'S,5'R)-5'-[2-[(1S,3R)-3-aminocyclopentyl]acetyl]-6-chloro-4'-(3-chloro-2-fluorophenyl)-2'-(2,2-dimethylpropyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one.
| Compound Name | (2'R,3S,4'S,5'R)-5'-[2-[(1S,3R)-3-aminocyclopentyl]acetyl]-6-chloro-4'-(3-chloro-2-fluorophenyl)-2'-(2,2-dimethylpropyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one |
|---|---|
| PubChem CID | 58254130 |
| Molecular Formula | C29H34Cl2FN3O2 |
| Molecular Weight | 546.51 g/mol |
| Exact Mass | 545.20 |
| IUPAC Name | (2'R,3S,4'S,5'R)-5'-[2-[(1S,3R)-3-aminocyclopentyl]acetyl]-6-chloro-4'-(3-chloro-2-fluorophenyl)-2'-(2,2-dimethylpropyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one |
| SMILES | CC(C)(C)C[C@H]1N[C@@H](C(=O)C[C@H]2CC[C@@H](N)C2)[C@H](c2cccc(Cl)c2F)[C@@]12C(=O)Nc1cc(Cl)ccc12 |
| InChI | InChI=1S/C29H34Cl2FN3O2/c1-28(2,3)14-23-29(19-10-8-16(30)13-21(19)34-27(29)37)24(18-5-4-6-20(31)25(18)32)26(35-23)22(36)12-15-7-9-17(33)11-15/h4-6,8,10,13,15,17,23-24,26,35H,7,9,11-12,14,33H2,1-3H3,(H,34,37)/t15-,17+,23+,24-,26-,29-/m0/s1 |
| InChIKey | USHUXQTZRPHXOD-PGURQNNUSA-N |
| XLogP | 5.97 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.51 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |