C29H33ClF2N2O3 — CID 58254186
(2'R,3S,4'S,5'R)-4'-(3-chloro-2-fluorophenyl)-2'-(2,2-dimethylpropyl)-6-fluoro-5'-[2-(3-hydroxy-3-methylcyclobutyl)acetyl]spiro[1H-indole-3,3'-pyrrolidine]-2-one (PubChem CID 58254186) has the molecular formula C29H33ClF2N2O3 and a molecular weight of 531.04 g/mol. Its IUPAC name is (2'R,3S,4'S,5'R)-4'-(3-chloro-2-fluorophenyl)-2'-(2,2-dimethylpropyl)-6-fluoro-5'-[2-(3-hydroxy-3-methylcyclobutyl)acetyl]spiro[1H-indole-3,3'-pyrrolidine]-2-one.
| Compound Name | (2'R,3S,4'S,5'R)-4'-(3-chloro-2-fluorophenyl)-2'-(2,2-dimethylpropyl)-6-fluoro-5'-[2-(3-hydroxy-3-methylcyclobutyl)acetyl]spiro[1H-indole-3,3'-pyrrolidine]-2-one |
|---|---|
| PubChem CID | 58254186 |
| Molecular Formula | C29H33ClF2N2O3 |
| Molecular Weight | 531.04 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | (2'R,3S,4'S,5'R)-4'-(3-chloro-2-fluorophenyl)-2'-(2,2-dimethylpropyl)-6-fluoro-5'-[2-(3-hydroxy-3-methylcyclobutyl)acetyl]spiro[1H-indole-3,3'-pyrrolidine]-2-one |
| SMILES | CC(C)(C)C[C@H]1N[C@@H](C(=O)CC2CC(C)(O)C2)[C@H](c2cccc(Cl)c2F)[C@@]12C(=O)Nc1cc(F)ccc12 |
| InChI | InChI=1S/C29H33ClF2N2O3/c1-27(2,3)14-22-29(18-9-8-16(31)11-20(18)33-26(29)36)23(17-6-5-7-19(30)24(17)32)25(34-22)21(35)10-15-12-28(4,37)13-15/h5-9,11,15,22-23,25,34,37H,10,12-14H2,1-4H3,(H,33,36)/t15?,22-,23+,25+,28?,29+/m1/s1 |
| InChIKey | QONHXKLEHFJCNU-CUQBUZDJSA-N |
| XLogP | 5.49 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.04 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |