C30H33Cl2FN2O3 — CID 58254372
(2'R,3S,4'S,5'R)-6-chloro-4'-(3-chloro-2-fluorophenyl)-2'-(cyclopentylmethyl)-5'-[2-(3-hydroxy-3-methylcyclobutyl)acetyl]spiro[1H-indole-3,3'-pyrrolidine]-2-one (PubChem CID 58254372) has the molecular formula C30H33Cl2FN2O3 and a molecular weight of 559.51 g/mol. Its IUPAC name is (2'R,3S,4'S,5'R)-6-chloro-4'-(3-chloro-2-fluorophenyl)-2'-(cyclopentylmethyl)-5'-[2-(3-hydroxy-3-methylcyclobutyl)acetyl]spiro[1H-indole-3,3'-pyrrolidine]-2-one.
| Compound Name | (2'R,3S,4'S,5'R)-6-chloro-4'-(3-chloro-2-fluorophenyl)-2'-(cyclopentylmethyl)-5'-[2-(3-hydroxy-3-methylcyclobutyl)acetyl]spiro[1H-indole-3,3'-pyrrolidine]-2-one |
|---|---|
| PubChem CID | 58254372 |
| Molecular Formula | C30H33Cl2FN2O3 |
| Molecular Weight | 559.51 g/mol |
| Exact Mass | 558.19 |
| IUPAC Name | (2'R,3S,4'S,5'R)-6-chloro-4'-(3-chloro-2-fluorophenyl)-2'-(cyclopentylmethyl)-5'-[2-(3-hydroxy-3-methylcyclobutyl)acetyl]spiro[1H-indole-3,3'-pyrrolidine]-2-one |
| SMILES | CC1(O)CC(CC(=O)[C@@H]2N[C@H](CC3CCCC3)[C@]3(C(=O)Nc4cc(Cl)ccc43)[C@H]2c2cccc(Cl)c2F)C1 |
| InChI | InChI=1S/C30H33Cl2FN2O3/c1-29(38)14-17(15-29)11-23(36)27-25(19-7-4-8-21(32)26(19)33)30(24(35-27)12-16-5-2-3-6-16)20-10-9-18(31)13-22(20)34-28(30)37/h4,7-10,13,16-17,24-25,27,35,38H,2-3,5-6,11-12,14-15H2,1H3,(H,34,37)/t17?,24-,25+,27+,29?,30+/m1/s1 |
| InChIKey | KDHMDJLLUQAHKG-VXJRPCPESA-N |
| XLogP | 6.15 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.51 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |