C29H33Cl2FN2O4 — CID 58254101
(2'R,3S,4'S,5'R)-6-chloro-4'-(3-chloro-2-fluorophenyl)-5'-[2-[(3S,4R)-3,4-dihydroxycyclopentyl]acetyl]-2'-(2,2-dimethylpropyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one (PubChem CID 58254101) has the molecular formula C29H33Cl2FN2O4 and a molecular weight of 563.50 g/mol. Its IUPAC name is (2'R,3S,4'S,5'R)-6-chloro-4'-(3-chloro-2-fluorophenyl)-5'-[2-[(3S,4R)-3,4-dihydroxycyclopentyl]acetyl]-2'-(2,2-dimethylpropyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one.
| Compound Name | (2'R,3S,4'S,5'R)-6-chloro-4'-(3-chloro-2-fluorophenyl)-5'-[2-[(3S,4R)-3,4-dihydroxycyclopentyl]acetyl]-2'-(2,2-dimethylpropyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one |
|---|---|
| PubChem CID | 58254101 |
| Molecular Formula | C29H33Cl2FN2O4 |
| Molecular Weight | 563.50 g/mol |
| Exact Mass | 562.18 |
| IUPAC Name | (2'R,3S,4'S,5'R)-6-chloro-4'-(3-chloro-2-fluorophenyl)-5'-[2-[(3S,4R)-3,4-dihydroxycyclopentyl]acetyl]-2'-(2,2-dimethylpropyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one |
| SMILES | CC(C)(C)C[C@H]1N[C@@H](C(=O)CC2C[C@@H](O)[C@@H](O)C2)[C@H](c2cccc(Cl)c2F)[C@@]12C(=O)Nc1cc(Cl)ccc12 |
| InChI | InChI=1S/C29H33Cl2FN2O4/c1-28(2,3)13-23-29(17-8-7-15(30)12-19(17)33-27(29)38)24(16-5-4-6-18(31)25(16)32)26(34-23)22(37)11-14-9-20(35)21(36)10-14/h4-8,12,14,20-21,23-24,26,34-36H,9-11,13H2,1-3H3,(H,33,38)/t14?,20-,21+,23-,24+,26+,29+/m1/s1 |
| InChIKey | TWQNUMUVMLITAD-BYGXCUENSA-N |
| XLogP | 4.97 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.50 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |