C32H38Cl2FN3O4 — CID 58254097
[4-[2-[(2'R,3S,3'S,5'R)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-yl]-2-oxoethyl]cyclohexyl] 2-aminoacetate (PubChem CID 58254097) has the molecular formula C32H38Cl2FN3O4 and a molecular weight of 618.58 g/mol. Its IUPAC name is [4-[2-[(2'R,3S,3'S,5'R)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-yl]-2-oxoethyl]cyclohexyl] 2-aminoacetate.
| Compound Name | [4-[2-[(2'R,3S,3'S,5'R)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-yl]-2-oxoethyl]cyclohexyl] 2-aminoacetate |
|---|---|
| PubChem CID | 58254097 |
| Molecular Formula | C32H38Cl2FN3O4 |
| Molecular Weight | 618.58 g/mol |
| Exact Mass | 617.22 |
| IUPAC Name | [4-[2-[(2'R,3S,3'S,5'R)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-yl]-2-oxoethyl]cyclohexyl] 2-aminoacetate |
| SMILES | CC(C)(C)C[C@H]1N[C@@H](C(=O)CC2CCC(OC(=O)CN)CC2)[C@H](c2cccc(Cl)c2F)[C@@]12C(=O)Nc1cc(Cl)ccc12 |
| InChI | InChI=1S/C32H38Cl2FN3O4/c1-31(2,3)15-25-32(21-12-9-18(33)14-23(21)37-30(32)41)27(20-5-4-6-22(34)28(20)35)29(38-25)24(39)13-17-7-10-19(11-8-17)42-26(40)16-36/h4-6,9,12,14,17,19,25,27,29,38H,7-8,10-11,13,15-16,36H2,1-3H3,(H,37,41)/t17?,19?,25-,27+,29+,32+/m1/s1 |
| InChIKey | XWCOSUXLYLTAHY-XGYPEWBQSA-N |
| XLogP | 5.90 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.58 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |