C27H29ClF2N2O2 — CID 58254233
(2'R,3S,4'S,5'R)-4'-(3-chloro-2-fluorophenyl)-5'-(2-cyclopropylacetyl)-2'-(2,2-dimethylpropyl)-6-fluorospiro[1H-indole-3,3'-pyrrolidine]-2-one (PubChem CID 58254233) has the molecular formula C27H29ClF2N2O2 and a molecular weight of 486.99 g/mol. Its IUPAC name is (2'R,3S,4'S,5'R)-4'-(3-chloro-2-fluorophenyl)-5'-(2-cyclopropylacetyl)-2'-(2,2-dimethylpropyl)-6-fluorospiro[1H-indole-3,3'-pyrrolidine]-2-one.
| Compound Name | (2'R,3S,4'S,5'R)-4'-(3-chloro-2-fluorophenyl)-5'-(2-cyclopropylacetyl)-2'-(2,2-dimethylpropyl)-6-fluorospiro[1H-indole-3,3'-pyrrolidine]-2-one |
|---|---|
| PubChem CID | 58254233 |
| Molecular Formula | C27H29ClF2N2O2 |
| Molecular Weight | 486.99 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | (2'R,3S,4'S,5'R)-4'-(3-chloro-2-fluorophenyl)-5'-(2-cyclopropylacetyl)-2'-(2,2-dimethylpropyl)-6-fluorospiro[1H-indole-3,3'-pyrrolidine]-2-one |
| SMILES | CC(C)(C)C[C@H]1N[C@@H](C(=O)CC2CC2)[C@H](c2cccc(Cl)c2F)[C@@]12C(=O)Nc1cc(F)ccc12 |
| InChI | InChI=1S/C27H29ClF2N2O2/c1-26(2,3)13-21-27(17-10-9-15(29)12-19(17)31-25(27)34)22(16-5-4-6-18(28)23(16)30)24(32-21)20(33)11-14-7-8-14/h4-6,9-10,12,14,21-22,24,32H,7-8,11,13H2,1-3H3,(H,31,34)/t21-,22+,24+,27+/m1/s1 |
| InChIKey | ZALRJRJYQICTQN-QRSXMVCTSA-N |
| XLogP | 5.74 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.99 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |