C31H38Cl2FN2O6P — CID 58254380
[4-[2-[(2'R,3S,3'S,5'R)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-yl]-2-oxoethyl]-1-methylcyclohexyl] dihydrogen phosphate (PubChem CID 58254380) has the molecular formula C31H38Cl2FN2O6P and a molecular weight of 655.53 g/mol. Its IUPAC name is [4-[2-[(2'R,3S,3'S,5'R)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-yl]-2-oxoethyl]-1-methylcyclohexyl] dihydrogen phosphate.
| Compound Name | [4-[2-[(2'R,3S,3'S,5'R)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-yl]-2-oxoethyl]-1-methylcyclohexyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 58254380 |
| Molecular Formula | C31H38Cl2FN2O6P |
| Molecular Weight | 655.53 g/mol |
| Exact Mass | 654.18 |
| IUPAC Name | [4-[2-[(2'R,3S,3'S,5'R)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-yl]-2-oxoethyl]-1-methylcyclohexyl] dihydrogen phosphate |
| SMILES | CC(C)(C)C[C@H]1N[C@@H](C(=O)CC2CCC(C)(OP(=O)(O)O)CC2)[C@H](c2cccc(Cl)c2F)[C@@]12C(=O)Nc1cc(Cl)ccc12 |
| InChI | InChI=1S/C31H38Cl2FN2O6P/c1-29(2,3)16-24-31(20-9-8-18(32)15-22(20)35-28(31)38)25(19-6-5-7-21(33)26(19)34)27(36-24)23(37)14-17-10-12-30(4,13-11-17)42-43(39,40)41/h5-9,15,17,24-25,27,36H,10-14,16H2,1-4H3,(H,35,38)(H2,39,40,41)/t17?,24-,25+,27+,30?,31+/m1/s1 |
| InChIKey | RIVINHBKSOIHEK-MOJMXLBYSA-N |
| XLogP | 6.90 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.53 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|