C31H37Cl2FN2O2 — CID 161265658
(2'S,3R,4'S)-6-chloro-4'-(3-chloro-2-fluorophenyl)-2'-(2,2-dimethylpropyl)-5'-[2-(4-methylcyclohexyl)acetyl]spiro[1H-indole-3,3'-pyrrolidine]-2-one (PubChem CID 161265658) has the molecular formula C31H37Cl2FN2O2 and a molecular weight of 559.55 g/mol. Its IUPAC name is (2'S,3R,4'S)-6-chloro-4'-(3-chloro-2-fluorophenyl)-2'-(2,2-dimethylpropyl)-5'-[2-(4-methylcyclohexyl)acetyl]spiro[1H-indole-3,3'-pyrrolidine]-2-one.
| Compound Name | (2'S,3R,4'S)-6-chloro-4'-(3-chloro-2-fluorophenyl)-2'-(2,2-dimethylpropyl)-5'-[2-(4-methylcyclohexyl)acetyl]spiro[1H-indole-3,3'-pyrrolidine]-2-one |
|---|---|
| PubChem CID | 161265658 |
| Molecular Formula | C31H37Cl2FN2O2 |
| Molecular Weight | 559.55 g/mol |
| Exact Mass | 558.22 |
| IUPAC Name | (2'S,3R,4'S)-6-chloro-4'-(3-chloro-2-fluorophenyl)-2'-(2,2-dimethylpropyl)-5'-[2-(4-methylcyclohexyl)acetyl]spiro[1H-indole-3,3'-pyrrolidine]-2-one |
| SMILES | CC1CCC(CC(=O)C2N[C@@H](CC(C)(C)C)[C@@]3(C(=O)Nc4cc(Cl)ccc43)[C@H]2c2cccc(Cl)c2F)CC1 |
| InChI | InChI=1S/C31H37Cl2FN2O2/c1-17-8-10-18(11-9-17)14-24(37)28-26(20-6-5-7-22(33)27(20)34)31(25(36-28)16-30(2,3)4)21-13-12-19(32)15-23(21)35-29(31)38/h5-7,12-13,15,17-18,25-26,28,36H,8-11,14,16H2,1-4H3,(H,35,38)/t17?,18?,25-,26-,28?,31+/m0/s1 |
| InChIKey | VDDKSUIZRYDYIW-CPGCYJPBSA-N |
| XLogP | 7.67 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.55 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |