C30H34Cl2FN3O3 — CID 53476988
(2'R,3R,3'S,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(cyclopentylmethyl)-N-(4-hydroxycyclohexyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide (PubChem CID 53476988) has the molecular formula C30H34Cl2FN3O3 and a molecular weight of 574.52 g/mol. Its IUPAC name is (2'R,3R,3'S,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(cyclopentylmethyl)-N-(4-hydroxycyclohexyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide.
| Compound Name | (2'R,3R,3'S,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(cyclopentylmethyl)-N-(4-hydroxycyclohexyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide |
|---|---|
| PubChem CID | 53476988 |
| Molecular Formula | C30H34Cl2FN3O3 |
| Molecular Weight | 574.52 g/mol |
| Exact Mass | 573.20 |
| IUPAC Name | (2'R,3R,3'S,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(cyclopentylmethyl)-N-(4-hydroxycyclohexyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide |
| SMILES | O=C(NC1CCC(O)CC1)[C@@H]1N[C@@H](CC2CCCC2)[C@@]2(C(=O)Nc3cc(Cl)ccc32)[C@H]1c1cccc(Cl)c1F |
| InChI | InChI=1S/C30H34Cl2FN3O3/c31-17-8-13-21-23(15-17)35-29(39)30(21)24(14-16-4-1-2-5-16)36-27(25(30)20-6-3-7-22(32)26(20)33)28(38)34-18-9-11-19(37)12-10-18/h3,6-8,13,15-16,18-19,24-25,27,36-37H,1-2,4-5,9-12,14H2,(H,34,38)(H,35,39)/t18?,19?,24-,25-,27+,30+/m0/s1 |
| InChIKey | ZDYVCXVZHZFCCZ-BXZSUTPBSA-N |
| XLogP | 5.45 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.52 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |