C31H38Cl2FN3O2 — CID 59385503
(2'R,3S,3'S,5'R)-6-chloro-3'-(3-chloro-2-fluorophenyl)-N-(2-cyclohexylethyl)-5'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide (PubChem CID 59385503) has the molecular formula C31H38Cl2FN3O2 and a molecular weight of 574.57 g/mol. Its IUPAC name is (2'R,3S,3'S,5'R)-6-chloro-3'-(3-chloro-2-fluorophenyl)-N-(2-cyclohexylethyl)-5'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide.
| Compound Name | (2'R,3S,3'S,5'R)-6-chloro-3'-(3-chloro-2-fluorophenyl)-N-(2-cyclohexylethyl)-5'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide |
|---|---|
| PubChem CID | 59385503 |
| Molecular Formula | C31H38Cl2FN3O2 |
| Molecular Weight | 574.57 g/mol |
| Exact Mass | 573.23 |
| IUPAC Name | (2'R,3S,3'S,5'R)-6-chloro-3'-(3-chloro-2-fluorophenyl)-N-(2-cyclohexylethyl)-5'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide |
| SMILES | CC(C)(C)C[C@H]1N[C@@H](C(=O)NCCC2CCCCC2)[C@H](c2cccc(Cl)c2F)[C@@]12C(=O)Nc1cc(Cl)ccc12 |
| InChI | InChI=1S/C31H38Cl2FN3O2/c1-30(2,3)17-24-31(21-13-12-19(32)16-23(21)36-29(31)39)25(20-10-7-11-22(33)26(20)34)27(37-24)28(38)35-15-14-18-8-5-4-6-9-18/h7,10-13,16,18,24-25,27,37H,4-6,8-9,14-15,17H2,1-3H3,(H,35,38)(H,36,39)/t24-,25+,27-,31+/m1/s1 |
| InChIKey | LNQFKEYQWSBIQB-OHMLLRHZSA-N |
| XLogP | 6.97 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.57 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |