C31H39Cl2FN4O2 — CID 52937962
(2'R,3S,3'S,5'R)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)-2-oxo-N-(3-piperidin-1-ylpropyl)spiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide (PubChem CID 52937962) has the molecular formula C31H39Cl2FN4O2 and a molecular weight of 589.58 g/mol. Its IUPAC name is (2'R,3S,3'S,5'R)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)-2-oxo-N-(3-piperidin-1-ylpropyl)spiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide.
| Compound Name | (2'R,3S,3'S,5'R)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)-2-oxo-N-(3-piperidin-1-ylpropyl)spiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide |
|---|---|
| PubChem CID | 52937962 |
| Molecular Formula | C31H39Cl2FN4O2 |
| Molecular Weight | 589.58 g/mol |
| Exact Mass | 588.24 |
| IUPAC Name | (2'R,3S,3'S,5'R)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)-2-oxo-N-(3-piperidin-1-ylpropyl)spiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide |
| SMILES | CC(C)(C)C[C@H]1N[C@@H](C(=O)NCCCN2CCCCC2)[C@H](c2cccc(Cl)c2F)[C@@]12C(=O)Nc1cc(Cl)ccc12 |
| InChI | InChI=1S/C31H39Cl2FN4O2/c1-30(2,3)18-24-31(21-12-11-19(32)17-23(21)36-29(31)40)25(20-9-7-10-22(33)26(20)34)27(37-24)28(39)35-13-8-16-38-14-5-4-6-15-38/h7,9-12,17,24-25,27,37H,4-6,8,13-16,18H2,1-3H3,(H,35,39)(H,36,40)/t24-,25+,27-,31+/m1/s1 |
| InChIKey | CNLUPKVITANMJE-OHMLLRHZSA-N |
| XLogP | 5.88 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.58 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|