C32H39Cl2F2N3O2 — CID 58254286
(2'R,3S,4'S,5'R)-6-chloro-4'-(3-chloro-2-fluorophenyl)-2'-(2,2-dimethylpropyl)-5-fluoro-5'-(6-pyrrolidin-1-ylhexanoyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one (PubChem CID 58254286) has the molecular formula C32H39Cl2F2N3O2 and a molecular weight of 606.59 g/mol. Its IUPAC name is (2'R,3S,4'S,5'R)-6-chloro-4'-(3-chloro-2-fluorophenyl)-2'-(2,2-dimethylpropyl)-5-fluoro-5'-(6-pyrrolidin-1-ylhexanoyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one.
| Compound Name | (2'R,3S,4'S,5'R)-6-chloro-4'-(3-chloro-2-fluorophenyl)-2'-(2,2-dimethylpropyl)-5-fluoro-5'-(6-pyrrolidin-1-ylhexanoyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one |
|---|---|
| PubChem CID | 58254286 |
| Molecular Formula | C32H39Cl2F2N3O2 |
| Molecular Weight | 606.59 g/mol |
| Exact Mass | 605.24 |
| IUPAC Name | (2'R,3S,4'S,5'R)-6-chloro-4'-(3-chloro-2-fluorophenyl)-2'-(2,2-dimethylpropyl)-5-fluoro-5'-(6-pyrrolidin-1-ylhexanoyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one |
| SMILES | CC(C)(C)C[C@H]1N[C@@H](C(=O)CCCCCN2CCCC2)[C@H](c2cccc(Cl)c2F)[C@@]12C(=O)Nc1cc(Cl)c(F)cc12 |
| InChI | InChI=1S/C32H39Cl2F2N3O2/c1-31(2,3)18-26-32(20-16-23(35)22(34)17-24(20)37-30(32)41)27(19-10-9-11-21(33)28(19)36)29(38-26)25(40)12-5-4-6-13-39-14-7-8-15-39/h9-11,16-17,26-27,29,38H,4-8,12-15,18H2,1-3H3,(H,37,41)/t26-,27+,29+,32+/m1/s1 |
| InChIKey | MUHLRNXQVWQYJK-DMLGLVBBSA-N |
| XLogP | 7.25 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.59 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|