C33H43Cl2FN4O2 — CID 58254359
(2'R,3S,4'S,5'R)-6-chloro-4'-(3-chloro-2-fluorophenyl)-2'-(2,2-dimethylpropyl)-5'-[4-(4-propan-2-ylpiperazin-1-yl)butanoyl]spiro[1H-indole-3,3'-pyrrolidine]-2-one (PubChem CID 58254359) has the molecular formula C33H43Cl2FN4O2 and a molecular weight of 617.64 g/mol. Its IUPAC name is (2'R,3S,4'S,5'R)-6-chloro-4'-(3-chloro-2-fluorophenyl)-2'-(2,2-dimethylpropyl)-5'-[4-(4-propan-2-ylpiperazin-1-yl)butanoyl]spiro[1H-indole-3,3'-pyrrolidine]-2-one.
| Compound Name | (2'R,3S,4'S,5'R)-6-chloro-4'-(3-chloro-2-fluorophenyl)-2'-(2,2-dimethylpropyl)-5'-[4-(4-propan-2-ylpiperazin-1-yl)butanoyl]spiro[1H-indole-3,3'-pyrrolidine]-2-one |
|---|---|
| PubChem CID | 58254359 |
| Molecular Formula | C33H43Cl2FN4O2 |
| Molecular Weight | 617.64 g/mol |
| Exact Mass | 616.27 |
| IUPAC Name | (2'R,3S,4'S,5'R)-6-chloro-4'-(3-chloro-2-fluorophenyl)-2'-(2,2-dimethylpropyl)-5'-[4-(4-propan-2-ylpiperazin-1-yl)butanoyl]spiro[1H-indole-3,3'-pyrrolidine]-2-one |
| SMILES | CC(C)N1CCN(CCCC(=O)[C@@H]2N[C@H](CC(C)(C)C)[C@]3(C(=O)Nc4cc(Cl)ccc43)[C@H]2c2cccc(Cl)c2F)CC1 |
| InChI | InChI=1S/C33H43Cl2FN4O2/c1-20(2)40-16-14-39(15-17-40)13-7-10-26(41)30-28(22-8-6-9-24(35)29(22)36)33(27(38-30)19-32(3,4)5)23-12-11-21(34)18-25(23)37-31(33)42/h6,8-9,11-12,18,20,27-28,30,38H,7,10,13-17,19H2,1-5H3,(H,37,42)/t27-,28+,30+,33+/m1/s1 |
| InChIKey | AOEHEKGMULLYIN-TZFHJCGVSA-N |
| XLogP | 6.26 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.64 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |