C31H42BrClN4O3 — CID 143284574
(2R,3R,4S,5R)-3-(3-bromophenyl)-4-[4-chloro-2-(methylamino)phenyl]-5-(2,2-dimethylpropyl)-4-formyl-N-(3-morpholin-4-ylpropyl)pyrrolidine-2-carboxamide (PubChem CID 143284574) has the molecular formula C31H42BrClN4O3 and a molecular weight of 634.06 g/mol. Its IUPAC name is (2R,3R,4S,5R)-3-(3-bromophenyl)-4-[4-chloro-2-(methylamino)phenyl]-5-(2,2-dimethylpropyl)-4-formyl-N-(3-morpholin-4-ylpropyl)pyrrolidine-2-carboxamide.
| Compound Name | (2R,3R,4S,5R)-3-(3-bromophenyl)-4-[4-chloro-2-(methylamino)phenyl]-5-(2,2-dimethylpropyl)-4-formyl-N-(3-morpholin-4-ylpropyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 143284574 |
| Molecular Formula | C31H42BrClN4O3 |
| Molecular Weight | 634.06 g/mol |
| Exact Mass | 632.21 |
| IUPAC Name | (2R,3R,4S,5R)-3-(3-bromophenyl)-4-[4-chloro-2-(methylamino)phenyl]-5-(2,2-dimethylpropyl)-4-formyl-N-(3-morpholin-4-ylpropyl)pyrrolidine-2-carboxamide |
| SMILES | CNc1cc(Cl)ccc1[C@]1(C=O)[C@@H](CC(C)(C)C)N[C@@H](C(=O)NCCCN2CCOCC2)[C@@H]1c1cccc(Br)c1 |
| InChI | InChI=1S/C31H42BrClN4O3/c1-30(2,3)19-26-31(20-38,24-10-9-23(33)18-25(24)34-4)27(21-7-5-8-22(32)17-21)28(36-26)29(39)35-11-6-12-37-13-15-40-16-14-37/h5,7-10,17-18,20,26-28,34,36H,6,11-16,19H2,1-4H3,(H,35,39)/t26-,27+,28-,31-/m1/s1 |
| InChIKey | OJZFSFRCNMVCPT-KWYVSSJISA-N |
| XLogP | 4.98 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.06 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|