C32H44BrFN4O4 — CID 163782393
(2R,3S,4S,5R)-3-(3-bromo-2-fluorophenyl)-5-(2,2-dimethylpropyl)-4-formyl-4-[4-methoxy-2-(methylamino)phenyl]-N-(3-morpholin-4-ylpropyl)pyrrolidine-2-carboxamide (PubChem CID 163782393) has the molecular formula C32H44BrFN4O4 and a molecular weight of 647.63 g/mol. Its IUPAC name is (2R,3S,4S,5R)-3-(3-bromo-2-fluorophenyl)-5-(2,2-dimethylpropyl)-4-formyl-4-[4-methoxy-2-(methylamino)phenyl]-N-(3-morpholin-4-ylpropyl)pyrrolidine-2-carboxamide.
| Compound Name | (2R,3S,4S,5R)-3-(3-bromo-2-fluorophenyl)-5-(2,2-dimethylpropyl)-4-formyl-4-[4-methoxy-2-(methylamino)phenyl]-N-(3-morpholin-4-ylpropyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 163782393 |
| Molecular Formula | C32H44BrFN4O4 |
| Molecular Weight | 647.63 g/mol |
| Exact Mass | 646.25 |
| IUPAC Name | (2R,3S,4S,5R)-3-(3-bromo-2-fluorophenyl)-5-(2,2-dimethylpropyl)-4-formyl-4-[4-methoxy-2-(methylamino)phenyl]-N-(3-morpholin-4-ylpropyl)pyrrolidine-2-carboxamide |
| SMILES | CNc1cc(OC)ccc1[C@]1(C=O)[C@@H](CC(C)(C)C)N[C@@H](C(=O)NCCCN2CCOCC2)[C@@H]1c1cccc(Br)c1F |
| InChI | InChI=1S/C32H44BrFN4O4/c1-31(2,3)19-26-32(20-39,23-11-10-21(41-5)18-25(23)35-4)27(22-8-6-9-24(33)28(22)34)29(37-26)30(40)36-12-7-13-38-14-16-42-17-15-38/h6,8-11,18,20,26-27,29,35,37H,7,12-17,19H2,1-5H3,(H,36,40)/t26-,27+,29-,32-/m1/s1 |
| InChIKey | MPQZKHZKWBYECJ-FDCUTXSFSA-N |
| XLogP | 4.47 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.63 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|