C28H38Cl2N4O — CID 129059456
(2R,3S,4R,5S)-4-amino-3-(3-chlorophenyl)-4-(4-chlorophenyl)-5-(2,2-dimethylpropyl)-N-(2-pyrrolidin-1-ylethyl)pyrrolidine-2-carboxamide (PubChem CID 129059456) has the molecular formula C28H38Cl2N4O and a molecular weight of 517.55 g/mol. Its IUPAC name is (2R,3S,4R,5S)-4-amino-3-(3-chlorophenyl)-4-(4-chlorophenyl)-5-(2,2-dimethylpropyl)-N-(2-pyrrolidin-1-ylethyl)pyrrolidine-2-carboxamide.
| Compound Name | (2R,3S,4R,5S)-4-amino-3-(3-chlorophenyl)-4-(4-chlorophenyl)-5-(2,2-dimethylpropyl)-N-(2-pyrrolidin-1-ylethyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 129059456 |
| Molecular Formula | C28H38Cl2N4O |
| Molecular Weight | 517.55 g/mol |
| Exact Mass | 516.24 |
| IUPAC Name | (2R,3S,4R,5S)-4-amino-3-(3-chlorophenyl)-4-(4-chlorophenyl)-5-(2,2-dimethylpropyl)-N-(2-pyrrolidin-1-ylethyl)pyrrolidine-2-carboxamide |
| SMILES | CC(C)(C)C[C@@H]1N[C@@H](C(=O)NCCN2CCCC2)[C@H](c2cccc(Cl)c2)[C@@]1(N)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H38Cl2N4O/c1-27(2,3)18-23-28(31,20-9-11-21(29)12-10-20)24(19-7-6-8-22(30)17-19)25(33-23)26(35)32-13-16-34-14-4-5-15-34/h6-12,17,23-25,33H,4-5,13-16,18,31H2,1-3H3,(H,32,35)/t23-,24-,25+,28+/m0/s1 |
| InChIKey | CQPFTFRNJZHXLR-WWQFTLRMSA-N |
| XLogP | 4.92 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.55 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |