C29H37Cl2N3O — CID 59249291
(2R,3R,4R,5S)-3-(3-chlorophenyl)-4-(4-chlorophenyl)-4-cyano-N-(3,3-dimethylbutyl)-5-(2,2-dimethylpropyl)pyrrolidine-2-carboxamide (PubChem CID 59249291) has the molecular formula C29H37Cl2N3O and a molecular weight of 514.54 g/mol. Its IUPAC name is (2R,3R,4R,5S)-3-(3-chlorophenyl)-4-(4-chlorophenyl)-4-cyano-N-(3,3-dimethylbutyl)-5-(2,2-dimethylpropyl)pyrrolidine-2-carboxamide.
| Compound Name | (2R,3R,4R,5S)-3-(3-chlorophenyl)-4-(4-chlorophenyl)-4-cyano-N-(3,3-dimethylbutyl)-5-(2,2-dimethylpropyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 59249291 |
| Molecular Formula | C29H37Cl2N3O |
| Molecular Weight | 514.54 g/mol |
| Exact Mass | 513.23 |
| IUPAC Name | (2R,3R,4R,5S)-3-(3-chlorophenyl)-4-(4-chlorophenyl)-4-cyano-N-(3,3-dimethylbutyl)-5-(2,2-dimethylpropyl)pyrrolidine-2-carboxamide |
| SMILES | CC(C)(C)CCNC(=O)[C@@H]1N[C@@H](CC(C)(C)C)[C@](C#N)(c2ccc(Cl)cc2)[C@H]1c1cccc(Cl)c1 |
| InChI | InChI=1S/C29H37Cl2N3O/c1-27(2,3)14-15-33-26(35)25-24(19-8-7-9-22(31)16-19)29(18-32,20-10-12-21(30)13-11-20)23(34-25)17-28(4,5)6/h7-13,16,23-25,34H,14-15,17H2,1-6H3,(H,33,35)/t23-,24-,25+,29-/m0/s1 |
| InChIKey | GGBUDIPPGZTNNO-VYUAFQCHSA-N |
| XLogP | 6.87 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.54 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |