C28H35Cl2N3O3 — CID 129059424
(2S,3R,4R,5S)-4-(4-chloro-2-methoxyphenyl)-3-(3-chlorophenyl)-4-cyano-5-(2,2-dimethylpropyl)-N-(4-hydroxybutyl)pyrrolidine-2-carboxamide (PubChem CID 129059424) has the molecular formula C28H35Cl2N3O3 and a molecular weight of 532.51 g/mol. Its IUPAC name is (2S,3R,4R,5S)-4-(4-chloro-2-methoxyphenyl)-3-(3-chlorophenyl)-4-cyano-5-(2,2-dimethylpropyl)-N-(4-hydroxybutyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S,3R,4R,5S)-4-(4-chloro-2-methoxyphenyl)-3-(3-chlorophenyl)-4-cyano-5-(2,2-dimethylpropyl)-N-(4-hydroxybutyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 129059424 |
| Molecular Formula | C28H35Cl2N3O3 |
| Molecular Weight | 532.51 g/mol |
| Exact Mass | 531.21 |
| IUPAC Name | (2S,3R,4R,5S)-4-(4-chloro-2-methoxyphenyl)-3-(3-chlorophenyl)-4-cyano-5-(2,2-dimethylpropyl)-N-(4-hydroxybutyl)pyrrolidine-2-carboxamide |
| SMILES | COc1cc(Cl)ccc1[C@@]1(C#N)[C@H](CC(C)(C)C)N[C@H](C(=O)NCCCCO)[C@@H]1c1cccc(Cl)c1 |
| InChI | InChI=1S/C28H35Cl2N3O3/c1-27(2,3)16-23-28(17-31,21-11-10-20(30)15-22(21)36-4)24(18-8-7-9-19(29)14-18)25(33-23)26(35)32-12-5-6-13-34/h7-11,14-15,23-25,33-34H,5-6,12-13,16H2,1-4H3,(H,32,35)/t23-,24-,25-,28-/m0/s1 |
| InChIKey | YUPIXMZTLHJUGG-MGDCHWCSSA-N |
| XLogP | 5.21 |
| TPSA | 94.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.51 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|