C27H33Cl2N3OS — CID 67297214
(2R,3R,4R,5S)-3-(3-chlorophenyl)-4-(4-chlorophenyl)-4-cyano-5-(2,2-dimethylpropyl)-N-(3-methylsulfanylpropyl)pyrrolidine-2-carboxamide (PubChem CID 67297214) has the molecular formula C27H33Cl2N3OS and a molecular weight of 518.55 g/mol. Its IUPAC name is (2R,3R,4R,5S)-3-(3-chlorophenyl)-4-(4-chlorophenyl)-4-cyano-5-(2,2-dimethylpropyl)-N-(3-methylsulfanylpropyl)pyrrolidine-2-carboxamide.
| Compound Name | (2R,3R,4R,5S)-3-(3-chlorophenyl)-4-(4-chlorophenyl)-4-cyano-5-(2,2-dimethylpropyl)-N-(3-methylsulfanylpropyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 67297214 |
| Molecular Formula | C27H33Cl2N3OS |
| Molecular Weight | 518.55 g/mol |
| Exact Mass | 517.17 |
| IUPAC Name | (2R,3R,4R,5S)-3-(3-chlorophenyl)-4-(4-chlorophenyl)-4-cyano-5-(2,2-dimethylpropyl)-N-(3-methylsulfanylpropyl)pyrrolidine-2-carboxamide |
| SMILES | CSCCCNC(=O)[C@@H]1N[C@@H](CC(C)(C)C)[C@](C#N)(c2ccc(Cl)cc2)[C@H]1c1cccc(Cl)c1 |
| InChI | InChI=1S/C27H33Cl2N3OS/c1-26(2,3)16-22-27(17-30,19-9-11-20(28)12-10-19)23(18-7-5-8-21(29)15-18)24(32-22)25(33)31-13-6-14-34-4/h5,7-12,15,22-24,32H,6,13-14,16H2,1-4H3,(H,31,33)/t22-,23-,24+,27-/m0/s1 |
| InChIKey | MKVKPRIBHGODHJ-LUFNOOMBSA-N |
| XLogP | 6.18 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.55 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|