C26H32Cl2N4O2 — CID 70941698
[(2R,3R,4R,5S)-3-(3-chlorophenyl)-4-(4-chlorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidin-2-yl] N-(3-aminopropyl)carbamate (PubChem CID 70941698) has the molecular formula C26H32Cl2N4O2 and a molecular weight of 503.47 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-3-(3-chlorophenyl)-4-(4-chlorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidin-2-yl] N-(3-aminopropyl)carbamate.
| Compound Name | [(2R,3R,4R,5S)-3-(3-chlorophenyl)-4-(4-chlorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidin-2-yl] N-(3-aminopropyl)carbamate |
|---|---|
| PubChem CID | 70941698 |
| Molecular Formula | C26H32Cl2N4O2 |
| Molecular Weight | 503.47 g/mol |
| Exact Mass | 502.19 |
| IUPAC Name | [(2R,3R,4R,5S)-3-(3-chlorophenyl)-4-(4-chlorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidin-2-yl] N-(3-aminopropyl)carbamate |
| SMILES | CC(C)(C)C[C@@H]1N[C@H](OC(=O)NCCCN)[C@H](c2cccc(Cl)c2)[C@@]1(C#N)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H32Cl2N4O2/c1-25(2,3)15-21-26(16-30,18-8-10-19(27)11-9-18)22(17-6-4-7-20(28)14-17)23(32-21)34-24(33)31-13-5-12-29/h4,6-11,14,21-23,32H,5,12-13,15,29H2,1-3H3,(H,31,33)/t21-,22-,23+,26-/m0/s1 |
| InChIKey | OBZMPXRQMYICSM-WOLJRWFJSA-N |
| XLogP | 5.35 |
| TPSA | 100.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.47 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|