C28H33Cl2N3O3 — CID 67296921
2-[[(2R,3R,4R,5S)-3-(3-chlorophenyl)-4-(4-chlorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carbonyl]amino]-3-methylbutanoic acid (PubChem CID 67296921) has the molecular formula C28H33Cl2N3O3 and a molecular weight of 530.50 g/mol. Its IUPAC name is 2-[[(2R,3R,4R,5S)-3-(3-chlorophenyl)-4-(4-chlorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carbonyl]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[(2R,3R,4R,5S)-3-(3-chlorophenyl)-4-(4-chlorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carbonyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 67296921 |
| Molecular Formula | C28H33Cl2N3O3 |
| Molecular Weight | 530.50 g/mol |
| Exact Mass | 529.19 |
| IUPAC Name | 2-[[(2R,3R,4R,5S)-3-(3-chlorophenyl)-4-(4-chlorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carbonyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)C(NC(=O)[C@@H]1N[C@@H](CC(C)(C)C)[C@](C#N)(c2ccc(Cl)cc2)[C@H]1c1cccc(Cl)c1)C(=O)O |
| InChI | InChI=1S/C28H33Cl2N3O3/c1-16(2)23(26(35)36)33-25(34)24-22(17-7-6-8-20(30)13-17)28(15-31,18-9-11-19(29)12-10-18)21(32-24)14-27(3,4)5/h6-13,16,21-24,32H,14H2,1-5H3,(H,33,34)(H,35,36)/t21-,22-,23?,24+,28-/m0/s1 |
| InChIKey | DFNMDCGTAQHKHZ-FQPYFDALSA-N |
| XLogP | 5.54 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.50 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |