C29H34Cl2N2O3 — CID 161425179
(2S)-4-[(2R,3R,4R,5S)-3-(3-chlorophenyl)-4-(4-chlorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidin-2-yl]-4-oxo-2-propan-2-ylbutanoic acid (PubChem CID 161425179) has the molecular formula C29H34Cl2N2O3 and a molecular weight of 529.51 g/mol. Its IUPAC name is (2S)-4-[(2R,3R,4R,5S)-3-(3-chlorophenyl)-4-(4-chlorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidin-2-yl]-4-oxo-2-propan-2-ylbutanoic acid.
| Compound Name | (2S)-4-[(2R,3R,4R,5S)-3-(3-chlorophenyl)-4-(4-chlorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidin-2-yl]-4-oxo-2-propan-2-ylbutanoic acid |
|---|---|
| PubChem CID | 161425179 |
| Molecular Formula | C29H34Cl2N2O3 |
| Molecular Weight | 529.51 g/mol |
| Exact Mass | 528.19 |
| IUPAC Name | (2S)-4-[(2R,3R,4R,5S)-3-(3-chlorophenyl)-4-(4-chlorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidin-2-yl]-4-oxo-2-propan-2-ylbutanoic acid |
| SMILES | CC(C)[C@H](CC(=O)[C@@H]1N[C@@H](CC(C)(C)C)[C@](C#N)(c2ccc(Cl)cc2)[C@H]1c1cccc(Cl)c1)C(=O)O |
| InChI | InChI=1S/C29H34Cl2N2O3/c1-17(2)22(27(35)36)14-23(34)26-25(18-7-6-8-21(31)13-18)29(16-32,19-9-11-20(30)12-10-19)24(33-26)15-28(3,4)5/h6-13,17,22,24-26,33H,14-15H2,1-5H3,(H,35,36)/t22-,24-,25-,26-,29-/m0/s1 |
| InChIKey | VXGMLUWRAKCBCG-IJTGDDBFSA-N |
| XLogP | 6.63 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.51 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |