C26H30Cl2N2O2 — CID 149414102
(2S,3R,4R,5R)-4-(3-chlorophenyl)-3-(4-chlorophenyl)-5-(5-hydroxypentanoyl)-2-(2-methylpropyl)pyrrolidine-3-carbonitrile (PubChem CID 149414102) has the molecular formula C26H30Cl2N2O2 and a molecular weight of 473.44 g/mol. Its IUPAC name is (2S,3R,4R,5R)-4-(3-chlorophenyl)-3-(4-chlorophenyl)-5-(5-hydroxypentanoyl)-2-(2-methylpropyl)pyrrolidine-3-carbonitrile.
| Compound Name | (2S,3R,4R,5R)-4-(3-chlorophenyl)-3-(4-chlorophenyl)-5-(5-hydroxypentanoyl)-2-(2-methylpropyl)pyrrolidine-3-carbonitrile |
|---|---|
| PubChem CID | 149414102 |
| Molecular Formula | C26H30Cl2N2O2 |
| Molecular Weight | 473.44 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | (2S,3R,4R,5R)-4-(3-chlorophenyl)-3-(4-chlorophenyl)-5-(5-hydroxypentanoyl)-2-(2-methylpropyl)pyrrolidine-3-carbonitrile |
| SMILES | CC(C)C[C@@H]1N[C@@H](C(=O)CCCCO)[C@H](c2cccc(Cl)c2)[C@@]1(C#N)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H30Cl2N2O2/c1-17(2)14-23-26(16-29,19-9-11-20(27)12-10-19)24(18-6-5-7-21(28)15-18)25(30-23)22(32)8-3-4-13-31/h5-7,9-12,15,17,23-25,30-31H,3-4,8,13-14H2,1-2H3/t23-,24-,25-,26-/m0/s1 |
| InChIKey | YRVJHLRXUSKQMN-CQJMVLFOSA-N |
| XLogP | 5.66 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.44 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|