C28H34Cl2N2O2 — CID 158554187
(2S,3R,4R,5R)-4-(3-chlorophenyl)-3-(4-chlorophenyl)-2-(2,2-dimethylpropyl)-5-(5-hydroxypentanoyl)-5-methylpyrrolidine-3-carbonitrile (PubChem CID 158554187) has the molecular formula C28H34Cl2N2O2 and a molecular weight of 501.50 g/mol. Its IUPAC name is (2S,3R,4R,5R)-4-(3-chlorophenyl)-3-(4-chlorophenyl)-2-(2,2-dimethylpropyl)-5-(5-hydroxypentanoyl)-5-methylpyrrolidine-3-carbonitrile.
| Compound Name | (2S,3R,4R,5R)-4-(3-chlorophenyl)-3-(4-chlorophenyl)-2-(2,2-dimethylpropyl)-5-(5-hydroxypentanoyl)-5-methylpyrrolidine-3-carbonitrile |
|---|---|
| PubChem CID | 158554187 |
| Molecular Formula | C28H34Cl2N2O2 |
| Molecular Weight | 501.50 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | (2S,3R,4R,5R)-4-(3-chlorophenyl)-3-(4-chlorophenyl)-2-(2,2-dimethylpropyl)-5-(5-hydroxypentanoyl)-5-methylpyrrolidine-3-carbonitrile |
| SMILES | CC(C)(C)C[C@@H]1N[C@@](C)(C(=O)CCCCO)[C@H](c2cccc(Cl)c2)[C@@]1(C#N)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H34Cl2N2O2/c1-26(2,3)17-23-28(18-31,20-11-13-21(29)14-12-20)25(19-8-7-9-22(30)16-19)27(4,32-23)24(34)10-5-6-15-33/h7-9,11-14,16,23,25,32-33H,5-6,10,15,17H2,1-4H3/t23-,25-,27-,28-/m0/s1 |
| InChIKey | HQBRLAOGCUWNIA-QSLMFXOGSA-N |
| XLogP | 6.44 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.50 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|