C27H32Cl2FN3O3 — CID 59249347
(2R,3R,4R,5S)-4-(4-chloro-2-fluorophenyl)-3-(3-chlorophenyl)-4-cyano-N-[(3S)-3,4-dihydroxybutyl]-5-(2,2-dimethylpropyl)pyrrolidine-2-carboxamide (PubChem CID 59249347) has the molecular formula C27H32Cl2FN3O3 and a molecular weight of 536.48 g/mol. Its IUPAC name is (2R,3R,4R,5S)-4-(4-chloro-2-fluorophenyl)-3-(3-chlorophenyl)-4-cyano-N-[(3S)-3,4-dihydroxybutyl]-5-(2,2-dimethylpropyl)pyrrolidine-2-carboxamide.
| Compound Name | (2R,3R,4R,5S)-4-(4-chloro-2-fluorophenyl)-3-(3-chlorophenyl)-4-cyano-N-[(3S)-3,4-dihydroxybutyl]-5-(2,2-dimethylpropyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 59249347 |
| Molecular Formula | C27H32Cl2FN3O3 |
| Molecular Weight | 536.48 g/mol |
| Exact Mass | 535.18 |
| IUPAC Name | (2R,3R,4R,5S)-4-(4-chloro-2-fluorophenyl)-3-(3-chlorophenyl)-4-cyano-N-[(3S)-3,4-dihydroxybutyl]-5-(2,2-dimethylpropyl)pyrrolidine-2-carboxamide |
| SMILES | CC(C)(C)C[C@@H]1N[C@@H](C(=O)NCC[C@H](O)CO)[C@H](c2cccc(Cl)c2)[C@@]1(C#N)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C27H32Cl2FN3O3/c1-26(2,3)13-22-27(15-31,20-8-7-18(29)12-21(20)30)23(16-5-4-6-17(28)11-16)24(33-22)25(36)32-10-9-19(35)14-34/h4-8,11-12,19,22-24,33-35H,9-10,13-14H2,1-3H3,(H,32,36)/t19-,22-,23-,24+,27-/m0/s1 |
| InChIKey | NNNSROISJHPOGB-QZFLLOCVSA-N |
| XLogP | 4.31 |
| TPSA | 105.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.48 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |