C29H33Cl2F2N3O3 — CID 59249450
(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2-cyclopropyl-2-methylpropyl)-N-[(3S)-3,4-dihydroxybutyl]pyrrolidine-2-carboxamide (PubChem CID 59249450) has the molecular formula C29H33Cl2F2N3O3 and a molecular weight of 580.50 g/mol. Its IUPAC name is (2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2-cyclopropyl-2-methylpropyl)-N-[(3S)-3,4-dihydroxybutyl]pyrrolidine-2-carboxamide.
| Compound Name | (2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2-cyclopropyl-2-methylpropyl)-N-[(3S)-3,4-dihydroxybutyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 59249450 |
| Molecular Formula | C29H33Cl2F2N3O3 |
| Molecular Weight | 580.50 g/mol |
| Exact Mass | 579.19 |
| IUPAC Name | (2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2-cyclopropyl-2-methylpropyl)-N-[(3S)-3,4-dihydroxybutyl]pyrrolidine-2-carboxamide |
| SMILES | CC(C)(C[C@@H]1N[C@@H](C(=O)NCC[C@H](O)CO)[C@H](c2cccc(Cl)c2F)[C@@]1(C#N)c1ccc(Cl)cc1F)C1CC1 |
| InChI | InChI=1S/C29H33Cl2F2N3O3/c1-28(2,16-6-7-16)13-23-29(15-34,20-9-8-17(30)12-22(20)32)24(19-4-3-5-21(31)25(19)33)26(36-23)27(39)35-11-10-18(38)14-37/h3-5,8-9,12,16,18,23-24,26,36-38H,6-7,10-11,13-14H2,1-2H3,(H,35,39)/t18-,23-,24-,26+,29-/m0/s1 |
| InChIKey | GYYFIXLIXBXDDF-AJJSGNABSA-N |
| XLogP | 4.84 |
| TPSA | 105.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.50 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |