C30H35Cl2F2N3O — CID 68619045
(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)-N-(4-methylcyclohexyl)pyrrolidine-2-carboxamide (PubChem CID 68619045) has the molecular formula C30H35Cl2F2N3O and a molecular weight of 562.53 g/mol. Its IUPAC name is (2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)-N-(4-methylcyclohexyl)pyrrolidine-2-carboxamide.
| Compound Name | (2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)-N-(4-methylcyclohexyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 68619045 |
| Molecular Formula | C30H35Cl2F2N3O |
| Molecular Weight | 562.53 g/mol |
| Exact Mass | 561.21 |
| IUPAC Name | (2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)-N-(4-methylcyclohexyl)pyrrolidine-2-carboxamide |
| SMILES | CC1CCC(NC(=O)[C@@H]2N[C@@H](CC(C)(C)C)[C@](C#N)(c3ccc(Cl)cc3F)[C@H]2c2cccc(Cl)c2F)CC1 |
| InChI | InChI=1S/C30H35Cl2F2N3O/c1-17-8-11-19(12-9-17)36-28(38)27-25(20-6-5-7-22(32)26(20)34)30(16-35,24(37-27)15-29(2,3)4)21-13-10-18(31)14-23(21)33/h5-7,10,13-14,17,19,24-25,27,37H,8-9,11-12,15H2,1-4H3,(H,36,38)/t17?,19?,24-,25-,27+,30-/m0/s1 |
| InChIKey | RRORJWPWFWVJLQ-CGNJMKSJSA-N |
| XLogP | 7.29 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.53 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |