C31H30Cl2F2IN3O — CID 59249325
(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)-N-(4-iodo-2,5-dimethylphenyl)pyrrolidine-2-carboxamide (PubChem CID 59249325) has the molecular formula C31H30Cl2F2IN3O and a molecular weight of 696.41 g/mol. Its IUPAC name is (2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)-N-(4-iodo-2,5-dimethylphenyl)pyrrolidine-2-carboxamide.
| Compound Name | (2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)-N-(4-iodo-2,5-dimethylphenyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 59249325 |
| Molecular Formula | C31H30Cl2F2IN3O |
| Molecular Weight | 696.41 g/mol |
| Exact Mass | 695.08 |
| IUPAC Name | (2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)-N-(4-iodo-2,5-dimethylphenyl)pyrrolidine-2-carboxamide |
| SMILES | Cc1cc(NC(=O)[C@@H]2N[C@@H](CC(C)(C)C)[C@](C#N)(c3ccc(Cl)cc3F)[C@H]2c2cccc(Cl)c2F)c(C)cc1I |
| InChI | InChI=1S/C31H30Cl2F2IN3O/c1-16-12-24(17(2)11-23(16)36)38-29(40)28-26(19-7-6-8-21(33)27(19)35)31(15-37,25(39-28)14-30(3,4)5)20-10-9-18(32)13-22(20)34/h6-13,25-26,28,39H,14H2,1-5H3,(H,38,40)/t25-,26-,28+,31-/m0/s1 |
| InChIKey | UCXMJWODNYPHHE-QBEYULMJSA-N |
| XLogP | 8.45 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.41 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|