C27H26Cl2F2N4O — CID 150856287
(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)-N-(1H-pyrrol-2-yl)pyrrolidine-2-carboxamide (PubChem CID 150856287) has the molecular formula C27H26Cl2F2N4O and a molecular weight of 531.43 g/mol. Its IUPAC name is (2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)-N-(1H-pyrrol-2-yl)pyrrolidine-2-carboxamide.
| Compound Name | (2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)-N-(1H-pyrrol-2-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 150856287 |
| Molecular Formula | C27H26Cl2F2N4O |
| Molecular Weight | 531.43 g/mol |
| Exact Mass | 530.15 |
| IUPAC Name | (2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)-N-(1H-pyrrol-2-yl)pyrrolidine-2-carboxamide |
| SMILES | CC(C)(C)C[C@@H]1N[C@@H](C(=O)Nc2ccc[nH]2)[C@H](c2cccc(Cl)c2F)[C@@]1(C#N)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C27H26Cl2F2N4O/c1-26(2,3)13-20-27(14-32,17-10-9-15(28)12-19(17)30)22(16-6-4-7-18(29)23(16)31)24(34-20)25(36)35-21-8-5-11-33-21/h4-12,20,22,24,33-34H,13H2,1-3H3,(H,35,36)/t20-,22-,24+,27-/m0/s1 |
| InChIKey | KRBOHIYALZKVLH-FEAPDONJSA-N |
| XLogP | 6.56 |
| TPSA | 80.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.43 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |