C31H29Cl2F2N3O3 — CID 59249266
2-[4-[[(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carbonyl]amino]phenyl]acetic acid (PubChem CID 59249266) has the molecular formula C31H29Cl2F2N3O3 and a molecular weight of 600.49 g/mol. Its IUPAC name is 2-[4-[[(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carbonyl]amino]phenyl]acetic acid.
| Compound Name | 2-[4-[[(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carbonyl]amino]phenyl]acetic acid |
|---|---|
| PubChem CID | 59249266 |
| Molecular Formula | C31H29Cl2F2N3O3 |
| Molecular Weight | 600.49 g/mol |
| Exact Mass | 599.16 |
| IUPAC Name | 2-[4-[[(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carbonyl]amino]phenyl]acetic acid |
| SMILES | CC(C)(C)C[C@@H]1N[C@@H](C(=O)Nc2ccc(CC(=O)O)cc2)[C@H](c2cccc(Cl)c2F)[C@@]1(C#N)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C31H29Cl2F2N3O3/c1-30(2,3)15-24-31(16-36,21-12-9-18(32)14-23(21)34)26(20-5-4-6-22(33)27(20)35)28(38-24)29(41)37-19-10-7-17(8-11-19)13-25(39)40/h4-12,14,24,26,28,38H,13,15H2,1-3H3,(H,37,41)(H,39,40)/t24-,26-,28+,31-/m0/s1 |
| InChIKey | IDTUVWIRCKDOKJ-ZPQYDTDLSA-N |
| XLogP | 6.86 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.49 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |