C33H32Cl2F2N2O3 — CID 147815502
3-[4-[2-[(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidin-2-yl]-2-oxoethyl]phenyl]propanoic acid (PubChem CID 147815502) has the molecular formula C33H32Cl2F2N2O3 and a molecular weight of 613.53 g/mol. Its IUPAC name is 3-[4-[2-[(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidin-2-yl]-2-oxoethyl]phenyl]propanoic acid.
| Compound Name | 3-[4-[2-[(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidin-2-yl]-2-oxoethyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 147815502 |
| Molecular Formula | C33H32Cl2F2N2O3 |
| Molecular Weight | 613.53 g/mol |
| Exact Mass | 612.18 |
| IUPAC Name | 3-[4-[2-[(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidin-2-yl]-2-oxoethyl]phenyl]propanoic acid |
| SMILES | CC(C)(C)C[C@@H]1N[C@@H](C(=O)Cc2ccc(CCC(=O)O)cc2)[C@H](c2cccc(Cl)c2F)[C@@]1(C#N)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C33H32Cl2F2N2O3/c1-32(2,3)17-27-33(18-38,23-13-12-21(34)16-25(23)36)29(22-5-4-6-24(35)30(22)37)31(39-27)26(40)15-20-9-7-19(8-10-20)11-14-28(41)42/h4-10,12-13,16,27,29,31,39H,11,14-15,17H2,1-3H3,(H,41,42)/t27-,29-,31-,33-/m0/s1 |
| InChIKey | HOFJMWIHGYVVHS-GKHPIFDXSA-N |
| XLogP | 7.42 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.53 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |