C33H33Cl2F2N3O3 — CID 53357489
methyl 3-[4-[[(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carbonyl]amino]phenyl]propanoate (PubChem CID 53357489) has the molecular formula C33H33Cl2F2N3O3 and a molecular weight of 628.55 g/mol. Its IUPAC name is methyl 3-[4-[[(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carbonyl]amino]phenyl]propanoate.
| Compound Name | methyl 3-[4-[[(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carbonyl]amino]phenyl]propanoate |
|---|---|
| PubChem CID | 53357489 |
| Molecular Formula | C33H33Cl2F2N3O3 |
| Molecular Weight | 628.55 g/mol |
| Exact Mass | 627.19 |
| IUPAC Name | methyl 3-[4-[[(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carbonyl]amino]phenyl]propanoate |
| SMILES | COC(=O)CCc1ccc(NC(=O)[C@@H]2N[C@@H](CC(C)(C)C)[C@](C#N)(c3ccc(Cl)cc3F)[C@H]2c2cccc(Cl)c2F)cc1 |
| InChI | InChI=1S/C33H33Cl2F2N3O3/c1-32(2,3)17-26-33(18-38,23-14-11-20(34)16-25(23)36)28(22-6-5-7-24(35)29(22)37)30(40-26)31(42)39-21-12-8-19(9-13-21)10-15-27(41)43-4/h5-9,11-14,16,26,28,30,40H,10,15,17H2,1-4H3,(H,39,42)/t26-,28-,30+,33-/m0/s1 |
| InChIKey | CXMWWKFROALZJT-SDIOCPQPSA-N |
| XLogP | 7.34 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.55 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |