C29H28Cl2F2N4O2 — CID 59249454
(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)-N-(6-methoxy-3-pyridinyl)pyrrolidine-2-carboxamide (PubChem CID 59249454) has the molecular formula C29H28Cl2F2N4O2 and a molecular weight of 573.47 g/mol. Its IUPAC name is (2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)-N-(6-methoxy-3-pyridinyl)pyrrolidine-2-carboxamide.
| Compound Name | (2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)-N-(6-methoxy-3-pyridinyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 59249454 |
| Molecular Formula | C29H28Cl2F2N4O2 |
| Molecular Weight | 573.47 g/mol |
| Exact Mass | 572.16 |
| IUPAC Name | (2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)-N-(6-methoxy-3-pyridinyl)pyrrolidine-2-carboxamide |
| SMILES | COc1ccc(NC(=O)[C@@H]2N[C@@H](CC(C)(C)C)[C@](C#N)(c3ccc(Cl)cc3F)[C@H]2c2cccc(Cl)c2F)cn1 |
| InChI | InChI=1S/C29H28Cl2F2N4O2/c1-28(2,3)13-22-29(15-34,19-10-8-16(30)12-21(19)32)24(18-6-5-7-20(31)25(18)33)26(37-22)27(38)36-17-9-11-23(39-4)35-14-17/h5-12,14,22,24,26,37H,13H2,1-4H3,(H,36,38)/t22-,24-,26+,29-/m0/s1 |
| InChIKey | YSXPSKQLZXKDFU-QRQOKOAMSA-N |
| XLogP | 6.64 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.47 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |