C30H28Cl2F2N4O3 — CID 53358817
methyl 6-[[(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carbonyl]amino]pyridine-3-carboxylate (PubChem CID 53358817) has the molecular formula C30H28Cl2F2N4O3 and a molecular weight of 601.48 g/mol. Its IUPAC name is methyl 6-[[(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carbonyl]amino]pyridine-3-carboxylate.
| Compound Name | methyl 6-[[(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carbonyl]amino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 53358817 |
| Molecular Formula | C30H28Cl2F2N4O3 |
| Molecular Weight | 601.48 g/mol |
| Exact Mass | 600.15 |
| IUPAC Name | methyl 6-[[(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carbonyl]amino]pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(NC(=O)[C@@H]2N[C@@H](CC(C)(C)C)[C@](C#N)(c3ccc(Cl)cc3F)[C@H]2c2cccc(Cl)c2F)nc1 |
| InChI | InChI=1S/C30H28Cl2F2N4O3/c1-29(2,3)13-22-30(15-35,19-10-9-17(31)12-21(19)33)24(18-6-5-7-20(32)25(18)34)26(37-22)27(39)38-23-11-8-16(14-36-23)28(40)41-4/h5-12,14,22,24,26,37H,13H2,1-4H3,(H,36,38,39)/t22-,24-,26+,30-/m0/s1 |
| InChIKey | MNACJEMUFOZKQE-SYRFEWCISA-N |
| XLogP | 6.41 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.48 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |