C34H30Cl2F2N4O2 — CID 53358943
(2R,3S,4R,5S)-N-(6-carbamoylnaphthalen-2-yl)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carboxamide (PubChem CID 53358943) has the molecular formula C34H30Cl2F2N4O2 and a molecular weight of 635.54 g/mol. Its IUPAC name is (2R,3S,4R,5S)-N-(6-carbamoylnaphthalen-2-yl)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carboxamide.
| Compound Name | (2R,3S,4R,5S)-N-(6-carbamoylnaphthalen-2-yl)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 53358943 |
| Molecular Formula | C34H30Cl2F2N4O2 |
| Molecular Weight | 635.54 g/mol |
| Exact Mass | 634.17 |
| IUPAC Name | (2R,3S,4R,5S)-N-(6-carbamoylnaphthalen-2-yl)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carboxamide |
| SMILES | CC(C)(C)C[C@@H]1N[C@@H](C(=O)Nc2ccc3cc(C(N)=O)ccc3c2)[C@H](c2cccc(Cl)c2F)[C@@]1(C#N)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C34H30Cl2F2N4O2/c1-33(2,3)16-27-34(17-39,24-12-10-21(35)15-26(24)37)28(23-5-4-6-25(36)29(23)38)30(42-27)32(44)41-22-11-9-18-13-20(31(40)43)8-7-19(18)14-22/h4-15,27-28,30,42H,16H2,1-3H3,(H2,40,43)(H,41,44)/t27-,28-,30+,34-/m0/s1 |
| InChIKey | RDRMSBQUUBPANI-QGHWIGIDSA-N |
| XLogP | 7.48 |
| TPSA | 108.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.54 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |