C31H31Cl2F2N3O3 — CID 129084020
(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)-N-[4-(hydroxymethyl)-2-methoxyphenyl]pyrrolidine-2-carboxamide (PubChem CID 129084020) has the molecular formula C31H31Cl2F2N3O3 and a molecular weight of 602.51 g/mol. Its IUPAC name is (2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)-N-[4-(hydroxymethyl)-2-methoxyphenyl]pyrrolidine-2-carboxamide.
| Compound Name | (2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)-N-[4-(hydroxymethyl)-2-methoxyphenyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 129084020 |
| Molecular Formula | C31H31Cl2F2N3O3 |
| Molecular Weight | 602.51 g/mol |
| Exact Mass | 601.17 |
| IUPAC Name | (2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)-N-[4-(hydroxymethyl)-2-methoxyphenyl]pyrrolidine-2-carboxamide |
| SMILES | COc1cc(CO)ccc1NC(=O)[C@@H]1N[C@@H](CC(C)(C)C)[C@](C#N)(c2ccc(Cl)cc2F)[C@H]1c1cccc(Cl)c1F |
| InChI | InChI=1S/C31H31Cl2F2N3O3/c1-30(2,3)14-25-31(16-36,20-10-9-18(32)13-22(20)34)26(19-6-5-7-21(33)27(19)35)28(38-25)29(40)37-23-11-8-17(15-39)12-24(23)41-4/h5-13,25-26,28,38-39H,14-15H2,1-4H3,(H,37,40)/t25-,26-,28+,31-/m0/s1 |
| InChIKey | IMTBHBFUMZIULL-QBEYULMJSA-N |
| XLogP | 6.73 |
| TPSA | 94.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.51 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |